C19H32NO4Si+ — CID 67585309
benzyl (1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 67585309) has the molecular formula C19H32NO4Si+ and a molecular weight of 366.55 g/mol. Its IUPAC name is benzyl (1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | benzyl (1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67585309 |
| Molecular Formula | C19H32NO4Si+ |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | benzyl (1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[N@@+](CO)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H32NO4Si/c1-19(2,3)25(4,5)24-17-11-12-20(13-17,15-21)18(22)23-14-16-9-7-6-8-10-16/h6-10,17,21H,11-15H2,1-5H3/q+1/t17-,20+/m0/s1 |
| InChIKey | LHFDUCPSPKMKFX-FXAWDEMLSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|