C25H42O5Si2 — CID 11049084
benzyl 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 11049084) has the molecular formula C25H42O5Si2 and a molecular weight of 478.78 g/mol. Its IUPAC name is benzyl 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | benzyl 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 11049084 |
| Molecular Formula | C25H42O5Si2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | benzyl 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=COC(C(=O)OCc2ccccc2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O5Si2/c1-24(2,3)31(7,8)29-20-16-17-27-22(21(20)30-32(9,10)25(4,5)6)23(26)28-18-19-14-12-11-13-15-19/h11-17,20-22H,18H2,1-10H3 |
| InChIKey | XJJQEYVTOOSUIO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|