C19H29BrO3Si — CID 10787877
(1S,2R,5S,6S)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxycyclohex-3-en-1-ol (PubChem CID 10787877) has the molecular formula C19H29BrO3Si and a molecular weight of 413.43 g/mol. Its IUPAC name is (1S,2R,5S,6S)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxycyclohex-3-en-1-ol.
| Compound Name | (1S,2R,5S,6S)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxycyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10787877 |
| Molecular Formula | C19H29BrO3Si |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (1S,2R,5S,6S)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxycyclohex-3-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@@H](OCc2ccccc2)[C@H](O)[C@@H]1Br |
| InChI | InChI=1S/C19H29BrO3Si/c1-19(2,3)24(4,5)23-15-11-12-16(18(21)17(15)20)22-13-14-9-7-6-8-10-14/h6-12,15-18,21H,13H2,1-5H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | CBABHERMACSYKF-MLHJIOFPSA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|