C20H30O4Si — CID 11100548
tert-butyl-dimethyl-[[(1R,2S,5S,7R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy]silane (PubChem CID 11100548) has the molecular formula C20H30O4Si and a molecular weight of 362.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2S,5S,7R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2S,5S,7R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy]silane |
|---|---|
| PubChem CID | 11100548 |
| Molecular Formula | C20H30O4Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2S,5S,7R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2C=C[C@H](OCc3ccccc3)[C@H]1O2 |
| InChI | InChI=1S/C20H30O4Si/c1-20(2,3)25(4,5)22-14-17-19-16(11-12-18(23-17)24-19)21-13-15-9-7-6-8-10-15/h6-12,16-19H,13-14H2,1-5H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | CDQQAEDCSIUWIV-ZSYWTGECSA-N |
| XLogP | 4.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|