C14H26O6SSi — CID 11405417
[(1R,2R,5R,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] methanesulfonate (PubChem CID 11405417) has the molecular formula C14H26O6SSi and a molecular weight of 350.51 g/mol. Its IUPAC name is [(1R,2R,5R,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] methanesulfonate.
| Compound Name | [(1R,2R,5R,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 11405417 |
| Molecular Formula | C14H26O6SSi |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(1R,2R,5R,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-3-en-2-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H]2C=C[C@@H](OS(C)(=O)=O)[C@@H]1O2 |
| InChI | InChI=1S/C14H26O6SSi/c1-14(2,3)22(5,6)17-9-11-13-10(20-21(4,15)16)7-8-12(18-11)19-13/h7-8,10-13H,9H2,1-6H3/t10-,11+,12-,13+/m1/s1 |
| InChIKey | QQXDLJZTTFORQN-XQHKEYJVSA-N |
| XLogP | 2.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|