C15H24O4SSi — CID 10065485
[(2R)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10065485) has the molecular formula C15H24O4SSi and a molecular weight of 328.51 g/mol. Its IUPAC name is [(2R)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10065485 |
| Molecular Formula | C15H24O4SSi |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(2R)-3-(benzenesulfonyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24O4SSi/c1-15(2,3)21(4,5)18-11-13-14(19-13)20(16,17)12-9-7-6-8-10-12/h6-10,13-14H,11H2,1-5H3/t13-,14?/m1/s1 |
| InChIKey | RVNYGTJJIWYBPN-KWCCSABGSA-N |
| XLogP | 3.21 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|