C35H58O7SSi2 — CID 99772740
[(2S,3S,4R,5R,6R)-6-[2-(benzenesulfonyl)ethyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 99772740) has the molecular formula C35H58O7SSi2 and a molecular weight of 679.08 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-6-[2-(benzenesulfonyl)ethyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4R,5R,6R)-6-[2-(benzenesulfonyl)ethyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 99772740 |
| Molecular Formula | C35H58O7SSi2 |
| Molecular Weight | 679.08 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-6-[2-(benzenesulfonyl)ethyl]-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](CCS(=O)(=O)c3ccccc3)[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H58O7SSi2/c1-26-31(25-40-44(9,10)34(2,3)4)41-30(22-23-43(36,37)29-16-14-13-15-17-29)33(42-45(11,12)35(5,6)7)32(26)39-24-27-18-20-28(38-8)21-19-27/h13-21,26,30-33H,22-25H2,1-12H3/t26-,30+,31+,32+,33+/m0/s1 |
| InChIKey | AWFILIAFFLBAKI-XSRGSHBZSA-N |
| XLogP | 8.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.08 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|