C21H36O5Si — CID 134896322
tert-butyl-[(2S,3R,4S,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-2-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 134896322) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4S,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-2-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4S,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-2-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134896322 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | tert-butyl-[(2S,3R,4S,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-2-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](OC)O[C@@H](C)[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H36O5Si/c1-15-20(26-27(7,8)21(2,3)4)18(13-19(23-6)25-15)24-14-16-9-11-17(22-5)12-10-16/h9-12,15,18-20H,13-14H2,1-8H3/t15-,18-,19-,20+/m0/s1 |
| InChIKey | ZLALJKGGEAQWTC-MVJPYGJCSA-N |
| XLogP | 4.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|