C14H20O5 — CID 122398669
(4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-6-methyloxane-2,4-diol (PubChem CID 122398669) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-6-methyloxane-2,4-diol.
| Compound Name | (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-6-methyloxane-2,4-diol |
|---|---|
| PubChem CID | 122398669 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-6-methyloxane-2,4-diol |
| SMILES | COc1ccc(CO[C@H]2[C@@H](O)CC(O)O[C@@H]2C)cc1 |
| InChI | InChI=1S/C14H20O5/c1-9-14(12(15)7-13(16)19-9)18-8-10-3-5-11(17-2)6-4-10/h3-6,9,12-16H,7-8H2,1-2H3/t9-,12+,13?,14-/m1/s1 |
| InChIKey | UZXHJGWHUMPEBM-ARKHKUHZSA-N |
| XLogP | 1.07 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |