C13H18O5 — CID 171123464
(4S,5S)-5-[(4-methoxyphenyl)methoxymethyl]oxolane-2,4-diol (PubChem CID 171123464) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (4S,5S)-5-[(4-methoxyphenyl)methoxymethyl]oxolane-2,4-diol.
| Compound Name | (4S,5S)-5-[(4-methoxyphenyl)methoxymethyl]oxolane-2,4-diol |
|---|---|
| PubChem CID | 171123464 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4S,5S)-5-[(4-methoxyphenyl)methoxymethyl]oxolane-2,4-diol |
| SMILES | COc1ccc(COC[C@@H]2OC(O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H18O5/c1-16-10-4-2-9(3-5-10)7-17-8-12-11(14)6-13(15)18-12/h2-5,11-15H,6-8H2,1H3/t11-,12-,13?/m0/s1 |
| InChIKey | QWBOMMNRVWEYCR-VYAYZGMFSA-N |
| XLogP | 0.68 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |