C25H32O5 — CID 134931156
(2S,3R,5Z,9S)-2-[(4-methoxyphenyl)methoxymethyl]-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-ol (PubChem CID 134931156) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is (2S,3R,5Z,9S)-2-[(4-methoxyphenyl)methoxymethyl]-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-ol.
| Compound Name | (2S,3R,5Z,9S)-2-[(4-methoxyphenyl)methoxymethyl]-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-ol |
|---|---|
| PubChem CID | 134931156 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (2S,3R,5Z,9S)-2-[(4-methoxyphenyl)methoxymethyl]-9-(phenylmethoxymethyl)-2,3,4,7,8,9-hexahydrooxonin-3-ol |
| SMILES | COc1ccc(COC[C@@H]2O[C@H](COCc3ccccc3)CC/C=C\C[C@H]2O)cc1 |
| InChI | InChI=1S/C25H32O5/c1-27-22-14-12-21(13-15-22)17-29-19-25-24(26)11-7-3-6-10-23(30-25)18-28-16-20-8-4-2-5-9-20/h2-5,7-9,12-15,23-26H,6,10-11,16-19H2,1H3/b7-3-/t23-,24+,25-/m0/s1 |
| InChIKey | PFBZCFVMXOPGIN-LKBDWFQJSA-N |
| XLogP | 4.28 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|