C24H32O7S — CID 22879001
(2R,3R,4S,5R,6S)-6-ethylsulfanyl-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol (PubChem CID 22879001) has the molecular formula C24H32O7S and a molecular weight of 464.58 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-ethylsulfanyl-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-6-ethylsulfanyl-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 22879001 |
| Molecular Formula | C24H32O7S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-ethylsulfanyl-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccc(OC)cc2)[C@H](O)[C@H](O)[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H32O7S/c1-4-32-24-23(30-14-17-7-11-19(28-3)12-8-17)22(26)21(25)20(31-24)15-29-13-16-5-9-18(27-2)10-6-16/h5-12,20-26H,4,13-15H2,1-3H3/t20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | LQPSPFUZTFFROK-BAHGYDIPSA-N |
| XLogP | 3.01 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |