C28H32O8S — CID 56611471
(2R,3R,4S,5R,6R)-6-(benzenesulfinyl)-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol (PubChem CID 56611471) has the molecular formula C28H32O8S and a molecular weight of 528.62 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(benzenesulfinyl)-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(benzenesulfinyl)-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 56611471 |
| Molecular Formula | C28H32O8S |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(benzenesulfinyl)-5-[(4-methoxyphenyl)methoxy]-2-[(4-methoxyphenyl)methoxymethyl]oxane-3,4-diol |
| SMILES | COc1ccc(COC[C@H]2O[C@H](S(=O)c3ccccc3)[C@H](OCc3ccc(OC)cc3)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C28H32O8S/c1-32-21-12-8-19(9-13-21)16-34-18-24-25(29)26(30)27(35-17-20-10-14-22(33-2)15-11-20)28(36-24)37(31)23-6-4-3-5-7-23/h3-15,24-30H,16-18H2,1-2H3/t24-,25+,26+,27-,28-,37?/m1/s1 |
| InChIKey | NYFQGGBGZSXWTQ-LQAFKAENSA-N |
| XLogP | 3.06 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |