C21H26O6 — CID 59863611
6-(4-methoxyphenoxy)-5-methyl-2-(phenylmethoxymethyl)oxane-3,4-diol (PubChem CID 59863611) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 6-(4-methoxyphenoxy)-5-methyl-2-(phenylmethoxymethyl)oxane-3,4-diol.
| Compound Name | 6-(4-methoxyphenoxy)-5-methyl-2-(phenylmethoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 59863611 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 6-(4-methoxyphenoxy)-5-methyl-2-(phenylmethoxymethyl)oxane-3,4-diol |
| SMILES | COc1ccc(OC2OC(COCc3ccccc3)C(O)C(O)C2C)cc1 |
| InChI | InChI=1S/C21H26O6/c1-14-19(22)20(23)18(13-25-12-15-6-4-3-5-7-15)27-21(14)26-17-10-8-16(24-2)9-11-17/h3-11,14,18-23H,12-13H2,1-2H3 |
| InChIKey | DHSBBSQQERSIEO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |