C22H28O6 — CID 71719675
(2S,3S,4S,5R,6S)-2-phenoxy-6-(phenylmethoxymethyl)-4-propoxyoxane-3,5-diol (PubChem CID 71719675) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-phenoxy-6-(phenylmethoxymethyl)-4-propoxyoxane-3,5-diol.
| Compound Name | (2S,3S,4S,5R,6S)-2-phenoxy-6-(phenylmethoxymethyl)-4-propoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 71719675 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-phenoxy-6-(phenylmethoxymethyl)-4-propoxyoxane-3,5-diol |
| SMILES | CCCO[C@@H]1[C@H](O)[C@H](Oc2ccccc2)O[C@@H](COCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C22H28O6/c1-2-13-26-21-19(23)18(15-25-14-16-9-5-3-6-10-16)28-22(20(21)24)27-17-11-7-4-8-12-17/h3-12,18-24H,2,13-15H2,1H3/t18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | UDNMKBWZAWAZBA-LILSUDLASA-N |
| XLogP | 2.52 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |