C33H34O6 — CID 13083854
(2S,3R,4S,5R,6R)-5-phenoxy-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol (PubChem CID 13083854) has the molecular formula C33H34O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-5-phenoxy-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol.
| Compound Name | (2S,3R,4S,5R,6R)-5-phenoxy-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 13083854 |
| Molecular Formula | C33H34O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (2S,3R,4S,5R,6R)-5-phenoxy-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol |
| SMILES | O[C@H]1[C@@H](Oc2ccccc2)[C@@H](COCc2ccccc2)O[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H34O6/c34-30-31(38-28-19-11-4-12-20-28)29(24-35-21-25-13-5-1-6-14-25)39-33(37-23-27-17-9-3-10-18-27)32(30)36-22-26-15-7-2-8-16-26/h1-20,29-34H,21-24H2/t29-,30+,31+,32-,33+/m1/s1 |
| InChIKey | GBSCIMODLBBSBB-CYEGLCQHSA-N |
| XLogP | 5.54 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |