C27H30O7 — CID 102260445
(2R,3S,4R,5S,6R)-2-hydroperoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol (PubChem CID 102260445) has the molecular formula C27H30O7 and a molecular weight of 466.53 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-hydroperoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol.
| Compound Name | (2R,3S,4R,5S,6R)-2-hydroperoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 102260445 |
| Molecular Formula | C27H30O7 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-hydroperoxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-ol |
| SMILES | OO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O7/c28-24-25(31-17-21-12-6-2-7-13-21)23(19-30-16-20-10-4-1-5-11-20)33-27(34-29)26(24)32-18-22-14-8-3-9-15-22/h1-15,23-29H,16-19H2/t23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | QIMMILULMMWJAI-KUDLYRENSA-N |
| XLogP | 3.95 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|