C27H36O8 — CID 171126123
(2R,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-methyloxan-2-yl]oxy-6-methyl-4-phenylmethoxyoxan-2-ol (PubChem CID 171126123) has the molecular formula C27H36O8 and a molecular weight of 488.58 g/mol. Its IUPAC name is (2R,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-methyloxan-2-yl]oxy-6-methyl-4-phenylmethoxyoxan-2-ol.
| Compound Name | (2R,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-methyloxan-2-yl]oxy-6-methyl-4-phenylmethoxyoxan-2-ol |
|---|---|
| PubChem CID | 171126123 |
| Molecular Formula | C27H36O8 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | (2R,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-[(4-methoxyphenyl)methoxy]-6-methyloxan-2-yl]oxy-6-methyl-4-phenylmethoxyoxan-2-ol |
| SMILES | COc1ccc(CO[C@@H]2C[C@H](O[C@@H]3[C@@H](C)O[C@@H](O)C[C@H]3OCc3ccccc3)O[C@H](C)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H36O8/c1-17-26(29)22(31-16-20-9-11-21(30-3)12-10-20)14-25(34-17)35-27-18(2)33-24(28)13-23(27)32-15-19-7-5-4-6-8-19/h4-12,17-18,22-29H,13-16H2,1-3H3/t17-,18-,22-,23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | WXUSWBJOBVAZRO-GMDUPDPASA-N |
| XLogP | 3.17 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |