C43H46O8 — CID 177454375
(2R,3R,4R,6R)-6-(4-methoxyphenoxy)-2-methyl-3-[(2S,4R,5R,6R)-6-methyl-4-naphthalen-2-yloxy-5-phenylmethoxyoxan-2-yl]oxy-4-phenylmethoxyoxane (PubChem CID 177454375) has the molecular formula C43H46O8 and a molecular weight of 690.83 g/mol. Its IUPAC name is (2R,3R,4R,6R)-6-(4-methoxyphenoxy)-2-methyl-3-[(2S,4R,5R,6R)-6-methyl-4-naphthalen-2-yloxy-5-phenylmethoxyoxan-2-yl]oxy-4-phenylmethoxyoxane.
| Compound Name | (2R,3R,4R,6R)-6-(4-methoxyphenoxy)-2-methyl-3-[(2S,4R,5R,6R)-6-methyl-4-naphthalen-2-yloxy-5-phenylmethoxyoxan-2-yl]oxy-4-phenylmethoxyoxane |
|---|---|
| PubChem CID | 177454375 |
| Molecular Formula | C43H46O8 |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | (2R,3R,4R,6R)-6-(4-methoxyphenoxy)-2-methyl-3-[(2S,4R,5R,6R)-6-methyl-4-naphthalen-2-yloxy-5-phenylmethoxyoxan-2-yl]oxy-4-phenylmethoxyoxane |
| SMILES | COc1ccc(O[C@@H]2C[C@@H](OCc3ccccc3)[C@H](O[C@H]3C[C@@H](Oc4ccc5ccccc5c4)[C@H](OCc4ccccc4)[C@@H](C)O3)[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C43H46O8/c1-29-42(46-28-32-14-8-5-9-15-32)39(49-37-19-18-33-16-10-11-17-34(33)24-37)26-41(47-29)51-43-30(2)48-40(50-36-22-20-35(44-3)21-23-36)25-38(43)45-27-31-12-6-4-7-13-31/h4-24,29-30,38-43H,25-28H2,1-3H3/t29-,30-,38-,39-,40-,41+,42-,43-/m1/s1 |
| InChIKey | ZHYSWYNCPGNPHN-QCUNADHGSA-N |
| XLogP | 8.50 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |