C28H51IO5Si2 — CID 117071244
tert-butyl-[[(2S,3S,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodo-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy]-dimethylsilane (PubChem CID 117071244) has the molecular formula C28H51IO5Si2 and a molecular weight of 650.79 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodo-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3S,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodo-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 117071244 |
| Molecular Formula | C28H51IO5Si2 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | tert-butyl-[[(2S,3S,4R,5R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-iodo-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]methoxy]-dimethylsilane |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)[C@@H]2I)cc1 |
| InChI | InChI=1S/C28H51IO5Si2/c1-20-23(18-32-35(9,10)27(2,3)4)34-24(19-33-36(11,12)28(5,6)7)25(29)26(20)31-17-21-13-15-22(30-8)16-14-21/h13-16,20,23-26H,17-19H2,1-12H3/t20-,23+,24?,25-,26+/m0/s1 |
| InChIKey | KKVKPMMMFSFXGB-PQLCGWRYSA-N |
| XLogP | 7.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|