C38H50Cl3NO9Si — CID 46237907
[(3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris[(4-methoxyphenyl)methoxy]oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 46237907) has the molecular formula C38H50Cl3NO9Si and a molecular weight of 799.26 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris[(4-methoxyphenyl)methoxy]oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris[(4-methoxyphenyl)methoxy]oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 46237907 |
| Molecular Formula | C38H50Cl3NO9Si |
| Molecular Weight | 799.26 g/mol |
| Exact Mass | 797.23 |
| IUPAC Name | [(3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris[(4-methoxyphenyl)methoxy]oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccc(OC)cc2)[C@H](OCc2ccc(OC)cc2)[C@@H]1OCc1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C38H50Cl3NO9Si/c1-37(2,3)52(7,8)49-24-31-32(46-21-25-9-15-28(43-4)16-10-25)33(47-22-26-11-17-29(44-5)18-12-26)34(35(50-31)51-36(42)38(39,40)41)48-23-27-13-19-30(45-6)20-14-27/h9-20,31-35,42H,21-24H2,1-8H3/b42-36+/t31-,32-,33+,34+,35?/m1/s1 |
| InChIKey | UTMIAFAISSQLJS-ODWBCEBRSA-N |
| XLogP | 8.88 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.26 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|