C25H42O5Si — CID 24812879
[(2R,3R,6Z,9R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-9-yl]methanol (PubChem CID 24812879) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is [(2R,3R,6Z,9R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-9-yl]methanol.
| Compound Name | [(2R,3R,6Z,9R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-9-yl]methanol |
|---|---|
| PubChem CID | 24812879 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [(2R,3R,6Z,9R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-9-yl]methanol |
| SMILES | COc1ccc(CO[C@@H]2CC/C=C(/C)C[C@H](CO)O[C@@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H42O5Si/c1-19-9-8-10-23(28-17-20-11-13-21(27-5)14-12-20)24(30-22(15-19)16-26)18-29-31(6,7)25(2,3)4/h9,11-14,22-24,26H,8,10,15-18H2,1-7H3/b19-9-/t22-,23-,24-/m1/s1 |
| InChIKey | IKJUEZXCJGTOGW-KPOKSBCLSA-N |
| XLogP | 5.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|