C27H39NO5SSi — CID 139673117
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methoxyphenyl)methoxy]-3-[(4-methoxyphenyl)methoxy]pyrrolidine-2-thione (PubChem CID 139673117) has the molecular formula C27H39NO5SSi and a molecular weight of 517.76 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methoxyphenyl)methoxy]-3-[(4-methoxyphenyl)methoxy]pyrrolidine-2-thione.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methoxyphenyl)methoxy]-3-[(4-methoxyphenyl)methoxy]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 139673117 |
| Molecular Formula | C27H39NO5SSi |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methoxyphenyl)methoxy]-3-[(4-methoxyphenyl)methoxy]pyrrolidine-2-thione |
| SMILES | COc1ccc(COC2C(=S)NC(CO[Si](C)(C)C(C)(C)C)C2OCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C27H39NO5SSi/c1-27(2,3)35(6,7)33-18-22-24(32-17-20-10-8-9-11-23(20)30-5)25(26(34)28-22)31-16-19-12-14-21(29-4)15-13-19/h8-15,22,24-25H,16-18H2,1-7H3,(H,28,34) |
| InChIKey | UQJHAGISOBVYOY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|