C41H56O8Si — CID 11285500
[(1R,2S,3R,5R,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-7-oxo-2,6-bis(phenylmethoxy)cyclooctyl] acetate (PubChem CID 11285500) has the molecular formula C41H56O8Si and a molecular weight of 704.98 g/mol. Its IUPAC name is [(1R,2S,3R,5R,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-7-oxo-2,6-bis(phenylmethoxy)cyclooctyl] acetate.
| Compound Name | [(1R,2S,3R,5R,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-7-oxo-2,6-bis(phenylmethoxy)cyclooctyl] acetate |
|---|---|
| PubChem CID | 11285500 |
| Molecular Formula | C41H56O8Si |
| Molecular Weight | 704.98 g/mol |
| Exact Mass | 704.37 |
| IUPAC Name | [(1R,2S,3R,5R,6R,8R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,4,8-trimethyl-7-oxo-2,6-bis(phenylmethoxy)cyclooctyl] acetate |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OCc3ccccc3)[C@H](OC(C)=O)[C@@H](C)C(=O)[C@H](OCc3ccccc3)[C@H](O[Si](C)(C)C(C)(C)C)C2(C)C)cc1 |
| InChI | InChI=1S/C41H56O8Si/c1-28-34(43)36(45-25-30-17-13-11-14-18-30)39(49-50(9,10)40(3,4)5)41(6,7)38(47-27-32-21-23-33(44-8)24-22-32)37(35(28)48-29(2)42)46-26-31-19-15-12-16-20-31/h11-24,28,35-39H,25-27H2,1-10H3/t28-,35+,36-,37-,38-,39-/m0/s1 |
| InChIKey | OIMWRRVBPUJCBG-ZEMKBXOSSA-N |
| XLogP | 8.32 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.98 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|