C30H52O8Si2 — CID 102390657
[(1S,2Z,4R,5R,6R,7S,8R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,8-dihydroxy-6-[(4-methoxyphenyl)methoxy]cyclooct-2-en-1-yl] acetate (PubChem CID 102390657) has the molecular formula C30H52O8Si2 and a molecular weight of 596.91 g/mol. Its IUPAC name is [(1S,2Z,4R,5R,6R,7S,8R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,8-dihydroxy-6-[(4-methoxyphenyl)methoxy]cyclooct-2-en-1-yl] acetate.
| Compound Name | [(1S,2Z,4R,5R,6R,7S,8R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,8-dihydroxy-6-[(4-methoxyphenyl)methoxy]cyclooct-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 102390657 |
| Molecular Formula | C30H52O8Si2 |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | [(1S,2Z,4R,5R,6R,7S,8R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7,8-dihydroxy-6-[(4-methoxyphenyl)methoxy]cyclooct-2-en-1-yl] acetate |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](O)[C@@H](O)[C@@H](OC(C)=O)/C=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H52O8Si2/c1-20(31)36-23-17-18-24(37-39(9,10)29(2,3)4)27(38-40(11,12)30(5,6)7)28(26(33)25(23)32)35-19-21-13-15-22(34-8)16-14-21/h13-18,23-28,32-33H,19H2,1-12H3/b18-17-/t23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | JIAZNQJFGCEFCS-UTZFZEQTSA-N |
| XLogP | 5.58 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|