C22H36O4Si — CID 25257173
(1R,2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclobutan-1-ol (PubChem CID 25257173) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (1R,2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclobutan-1-ol.
| Compound Name | (1R,2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 25257173 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (1R,2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-[2-[(4-methoxyphenyl)methoxy]ethyl]cyclobutan-1-ol |
| SMILES | C=C[C@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H36O4Si/c1-8-18-19(21(20(18)23)26-27(6,7)22(2,3)4)13-14-25-15-16-9-11-17(24-5)12-10-16/h8-12,18-21,23H,1,13-15H2,2-7H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | KPTMDOAEBNUTCQ-XRXFAXGQSA-N |
| XLogP | 4.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|