C25H42O4Si — CID 52951766
tert-butyl-[(1R)-1-[(2R,5R)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolan-2-yl]-3-methylbut-2-enoxy]-dimethylsilane (PubChem CID 52951766) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(2R,5R)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolan-2-yl]-3-methylbut-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(2R,5R)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolan-2-yl]-3-methylbut-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 52951766 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | tert-butyl-[(1R)-1-[(2R,5R)-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolan-2-yl]-3-methylbut-2-enoxy]-dimethylsilane |
| SMILES | COc1ccc(COCC[C@H]2CC[C@H]([C@@H](C=C(C)C)O[Si](C)(C)C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C25H42O4Si/c1-19(2)17-24(29-30(7,8)25(3,4)5)23-14-13-22(28-23)15-16-27-18-20-9-11-21(26-6)12-10-20/h9-12,17,22-24H,13-16,18H2,1-8H3/t22-,23-,24-/m1/s1 |
| InChIKey | AOIBPRVZKAMYFL-WXFUMESZSA-N |
| XLogP | 6.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|