C22H37BrO3Si — CID 59051507
[(E,3R)-7-bromo-1-[(4-methoxyphenyl)methoxy]-5-methylhept-5-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 59051507) has the molecular formula C22H37BrO3Si and a molecular weight of 457.53 g/mol. Its IUPAC name is [(E,3R)-7-bromo-1-[(4-methoxyphenyl)methoxy]-5-methylhept-5-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,3R)-7-bromo-1-[(4-methoxyphenyl)methoxy]-5-methylhept-5-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59051507 |
| Molecular Formula | C22H37BrO3Si |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [(E,3R)-7-bromo-1-[(4-methoxyphenyl)methoxy]-5-methylhept-5-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(COCC[C@@H](C/C(C)=C/CBr)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H37BrO3Si/c1-18(12-14-23)16-21(26-27(6,7)22(2,3)4)13-15-25-17-19-8-10-20(24-5)11-9-19/h8-12,21H,13-17H2,1-7H3/b18-12+/t21-/m0/s1 |
| InChIKey | XVGGMNLHUPDTSD-QFTJCQGQSA-N |
| XLogP | 6.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|