C26H46O6Si — CID 52951078
methyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,2,4-trimethylheptanoate (PubChem CID 52951078) has the molecular formula C26H46O6Si and a molecular weight of 482.73 g/mol. Its IUPAC name is methyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,2,4-trimethylheptanoate.
| Compound Name | methyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,2,4-trimethylheptanoate |
|---|---|
| PubChem CID | 52951078 |
| Molecular Formula | C26H46O6Si |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | methyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-7-[(4-methoxyphenyl)methoxy]-2,2,4-trimethylheptanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](OC)[C@H](C)[C@H](CCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O6Si/c1-19(23(29-8)26(5,6)24(27)30-9)22(32-33(10,11)25(2,3)4)16-17-31-18-20-12-14-21(28-7)15-13-20/h12-15,19,22-23H,16-18H2,1-11H3/t19-,22+,23+/m1/s1 |
| InChIKey | GAMHTPMKQUXALW-OIBXWCBGSA-N |
| XLogP | 5.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|