C41H80O6Si3 — CID 101420356
(3S,6R,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-4,4,6,8-tetramethylundecan-5-one (PubChem CID 101420356) has the molecular formula C41H80O6Si3 and a molecular weight of 753.34 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-4,4,6,8-tetramethylundecan-5-one.
| Compound Name | (3S,6R,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-4,4,6,8-tetramethylundecan-5-one |
|---|---|
| PubChem CID | 101420356 |
| Molecular Formula | C41H80O6Si3 |
| Molecular Weight | 753.34 g/mol |
| Exact Mass | 752.53 |
| IUPAC Name | (3S,6R,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-11-[(4-methoxyphenyl)methoxy]-4,4,6,8-tetramethylundecan-5-one |
| SMILES | COc1ccc(COCCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H80O6Si3/c1-31(22-21-28-44-30-33-23-25-34(43-14)26-24-33)36(47-50(19,20)40(9,10)11)32(2)37(42)41(12,13)35(46-49(17,18)39(6,7)8)27-29-45-48(15,16)38(3,4)5/h23-26,31-32,35-36H,21-22,27-30H2,1-20H3/t31-,32+,35-,36-/m0/s1 |
| InChIKey | JJCNKOMDULKPGI-KDDXCEFCSA-N |
| XLogP | 12.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.34 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|