C23H39NO5Si — CID 91400934
methyl (3S)-2-acetyl-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methylamino]-4-methylpentanoate (PubChem CID 91400934) has the molecular formula C23H39NO5Si and a molecular weight of 437.65 g/mol. Its IUPAC name is methyl (3S)-2-acetyl-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methylamino]-4-methylpentanoate.
| Compound Name | methyl (3S)-2-acetyl-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 91400934 |
| Molecular Formula | C23H39NO5Si |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | methyl (3S)-2-acetyl-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(NCc1ccc(OC)cc1)(C(C)=O)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H39NO5Si/c1-16(2)20(29-30(9,10)22(4,5)6)23(17(3)25,21(26)28-8)24-15-18-11-13-19(27-7)14-12-18/h11-14,16,20,24H,15H2,1-10H3/t20-,23?/m0/s1 |
| InChIKey | SEHAFAPFTKCXGG-AJZOCDQUSA-N |
| XLogP | 4.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|