C20H36O4Si — CID 56647550
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-ol (PubChem CID 56647550) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-ol.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 56647550 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-ol |
| SMILES | COc1ccc(COC(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C20H36O4Si/c1-15(21)18(24-25(8,9)19(2,3)4)20(5,6)23-14-16-10-12-17(22-7)13-11-16/h10-13,15,18,21H,14H2,1-9H3/t15-,18+/m1/s1 |
| InChIKey | CFIYSHTZGFAVCG-QAPCUYQASA-N |
| XLogP | 4.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|