C19H32N2O3Si — CID 102094659
(3S,4R)-3-amino-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pentanenitrile (PubChem CID 102094659) has the molecular formula C19H32N2O3Si and a molecular weight of 364.56 g/mol. Its IUPAC name is (3S,4R)-3-amino-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pentanenitrile.
| Compound Name | (3S,4R)-3-amino-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pentanenitrile |
|---|---|
| PubChem CID | 102094659 |
| Molecular Formula | C19H32N2O3Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3S,4R)-3-amino-2-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]pentanenitrile |
| SMILES | COc1ccc(CO[C@H](C)[C@H](N)C(C#N)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O3Si/c1-14(23-13-15-8-10-16(22-5)11-9-15)18(21)17(12-20)24-25(6,7)19(2,3)4/h8-11,14,17-18H,13,21H2,1-7H3/t14-,17?,18+/m1/s1 |
| InChIKey | JMURCQAJKGOJLD-CFNGDTMJSA-N |
| XLogP | 3.84 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|