C35H51NO7Si — CID 11828294
(2R,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris[(4-methoxyphenyl)methoxy]pentan-2-amine (PubChem CID 11828294) has the molecular formula C35H51NO7Si and a molecular weight of 625.88 g/mol. Its IUPAC name is (2R,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris[(4-methoxyphenyl)methoxy]pentan-2-amine.
| Compound Name | (2R,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris[(4-methoxyphenyl)methoxy]pentan-2-amine |
|---|---|
| PubChem CID | 11828294 |
| Molecular Formula | C35H51NO7Si |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | (2R,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris[(4-methoxyphenyl)methoxy]pentan-2-amine |
| SMILES | COc1ccc(COC[C@@H](N)[C@@H](OCc2ccc(OC)cc2)[C@@H](CO[Si](C)(C)C(C)(C)C)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H51NO7Si/c1-35(2,3)44(7,8)43-25-33(41-22-27-11-17-30(38-5)18-12-27)34(42-23-28-13-19-31(39-6)20-14-28)32(36)24-40-21-26-9-15-29(37-4)16-10-26/h9-20,32-34H,21-25,36H2,1-8H3/t32-,33-,34-/m1/s1 |
| InChIKey | GUHPKBDMPBGUDE-CKOYEXALSA-N |
| XLogP | 6.75 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|