C21H36O5Si — CID 11761109
(E,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hept-2-ene-1,6-diol (PubChem CID 11761109) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (E,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hept-2-ene-1,6-diol.
| Compound Name | (E,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hept-2-ene-1,6-diol |
|---|---|
| PubChem CID | 11761109 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (E,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]hept-2-ene-1,6-diol |
| SMILES | COc1ccc(CO[C@@H](C/C=C/CO)[C@@H](O)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H36O5Si/c1-21(2,3)27(5,6)26-16-19(23)20(9-7-8-14-22)25-15-17-10-12-18(24-4)13-11-17/h7-8,10-13,19-20,22-23H,9,14-16H2,1-6H3/b8-7+/t19-,20-/m0/s1 |
| InChIKey | KANFWCPTKWZWJY-RLFQVEEXSA-N |
| XLogP | 3.90 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|