C20H32O5Si — CID 11349523
(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2-methylpent-2-enoic acid (PubChem CID 11349523) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2-methylpent-2-enoic acid.
| Compound Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 11349523 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-2-methylpent-2-enoic acid |
| SMILES | COc1ccc(CO[C@H](/C=C(\C)C(=O)O)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O5Si/c1-15(19(21)22)12-18(14-25-26(6,7)20(2,3)4)24-13-16-8-10-17(23-5)11-9-16/h8-12,18H,13-14H2,1-7H3,(H,21,22)/b15-12+/t18-/m1/s1 |
| InChIKey | BAALUEPDEFAKLN-NKAIQICCSA-N |
| XLogP | 4.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|