C25H44O5Si — CID 154707062
(Z,3R,4S,7S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-5-ene-1,7-diol (PubChem CID 154707062) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is (Z,3R,4S,7S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-5-ene-1,7-diol.
| Compound Name | (Z,3R,4S,7S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-5-ene-1,7-diol |
|---|---|
| PubChem CID | 154707062 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (Z,3R,4S,7S,8R)-9-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-5-ene-1,7-diol |
| SMILES | COc1ccc(CO[C@H](CCO)[C@@H](C)/C=C\[C@H](O)[C@H](C)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H44O5Si/c1-19(9-14-23(27)20(2)17-30-31(7,8)25(3,4)5)24(15-16-26)29-18-21-10-12-22(28-6)13-11-21/h9-14,19-20,23-24,26-27H,15-18H2,1-8H3/b14-9-/t19-,20+,23-,24+/m0/s1 |
| InChIKey | IZQBQROVWVSMBY-QNHDFUBHSA-N |
| XLogP | 5.17 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|