C36H62O6Si2 — CID 10699403
(3S,5R,6S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-6-phenylmethoxyheptan-1-ol (PubChem CID 10699403) has the molecular formula C36H62O6Si2 and a molecular weight of 647.06 g/mol. Its IUPAC name is (3S,5R,6S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-6-phenylmethoxyheptan-1-ol.
| Compound Name | (3S,5R,6S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-6-phenylmethoxyheptan-1-ol |
|---|---|
| PubChem CID | 10699403 |
| Molecular Formula | C36H62O6Si2 |
| Molecular Weight | 647.06 g/mol |
| Exact Mass | 646.41 |
| IUPAC Name | (3S,5R,6S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4-methoxyphenyl)methoxy]-4,4-dimethyl-6-phenylmethoxyheptan-1-ol |
| SMILES | COc1ccc(CO[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)OCc2ccccc2)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H62O6Si2/c1-34(2,3)43(10,11)41-27-31(39-25-28-17-15-14-16-18-28)33(40-26-29-19-21-30(38-9)22-20-29)36(7,8)32(23-24-37)42-44(12,13)35(4,5)6/h14-22,31-33,37H,23-27H2,1-13H3/t31-,32-,33-/m0/s1 |
| InChIKey | ZQKXQGNLSIRNOX-ZDCRTTOTSA-N |
| XLogP | 8.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.06 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|