C29H56O5Si2 — CID 14378941
(2S,3R,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol (PubChem CID 14378941) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol.
| Compound Name | (2S,3R,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol |
|---|---|
| PubChem CID | 14378941 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | (2S,3R,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptan-1-ol |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H](OCc1ccc(OC)cc1)[C@@H](C)CO |
| InChI | InChI=1S/C29H56O5Si2/c1-15-25(33-35(11,12)27(3,4)5)29(9,34-36(13,14)28(6,7)8)26(22(2)20-30)32-21-23-16-18-24(31-10)19-17-23/h16-19,22,25-26,30H,15,20-21H2,1-14H3/t22-,25+,26+,29+/m0/s1 |
| InChIKey | NUETYSRPGZHCEZ-YDERHJMWSA-N |
| XLogP | 7.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|