C26H46O4Si2 — CID 15606034
(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-5-methyl-8-trimethylsilyloct-7-yn-1-ol (PubChem CID 15606034) has the molecular formula C26H46O4Si2 and a molecular weight of 478.82 g/mol. Its IUPAC name is (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-5-methyl-8-trimethylsilyloct-7-yn-1-ol.
| Compound Name | (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-5-methyl-8-trimethylsilyloct-7-yn-1-ol |
|---|---|
| PubChem CID | 15606034 |
| Molecular Formula | C26H46O4Si2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]-5-methyl-8-trimethylsilyloct-7-yn-1-ol |
| SMILES | COc1ccc(CO[C@@H](CO)[C@@H](C[C@H](C)CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H46O4Si2/c1-21(12-11-17-31(6,7)8)18-24(30-32(9,10)26(2,3)4)25(19-27)29-20-22-13-15-23(28-5)16-14-22/h13-16,21,24-25,27H,12,18-20H2,1-10H3/t21-,24-,25+/m1/s1 |
| InChIKey | WTZVKNLHEZVBJF-SDUSCBPUSA-N |
| XLogP | 6.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|