C25H40O5Si — CID 101272553
(2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-[(4-methoxyphenyl)methoxy]dec-8-ynal (PubChem CID 101272553) has the molecular formula C25H40O5Si and a molecular weight of 448.68 g/mol. Its IUPAC name is (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-[(4-methoxyphenyl)methoxy]dec-8-ynal.
| Compound Name | (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-[(4-methoxyphenyl)methoxy]dec-8-ynal |
|---|---|
| PubChem CID | 101272553 |
| Molecular Formula | C25H40O5Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (2S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-[(4-methoxyphenyl)methoxy]dec-8-ynal |
| SMILES | CC#CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C=O)OCc1ccc(OC)cc1)OC |
| InChI | InChI=1S/C25H40O5Si/c1-9-10-11-12-23(30-31(7,8)25(2,3)4)24(28-6)17-22(18-26)29-19-20-13-15-21(27-5)16-14-20/h13-16,18,22-24H,11-12,17,19H2,1-8H3/t22-,23-,24-/m0/s1 |
| InChIKey | OSISFNBOTKSRFO-HJOGWXRNSA-N |
| XLogP | 5.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|