C21H34O3Si — CID 15814219
tert-butyl-[(2S,3S,4S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-yn-2-yl]oxy-dimethylsilane (PubChem CID 15814219) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-yn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-yn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15814219 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | tert-butyl-[(2S,3S,4S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H](C)[C@H](OCc1ccc(OC)cc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-10-16(2)20(17(3)24-25(8,9)21(4,5)6)23-15-18-11-13-19(22-7)14-12-18/h1,11-14,16-17,20H,15H2,2-9H3/t16-,17-,20-/m0/s1 |
| InChIKey | ISDFYFGKMZDVCQ-ZWOKBUDYSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|