C25H42O4Si — CID 11750897
(E,2R,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enal (PubChem CID 11750897) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is (E,2R,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enal.
| Compound Name | (E,2R,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enal |
|---|---|
| PubChem CID | 11750897 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (E,2R,3R,6S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethyloct-4-enal |
| SMILES | COc1ccc(CO[C@@H](C)[C@@H](C)/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)cc1 |
| InChI | InChI=1S/C25H42O4Si/c1-18(21(4)28-17-22-11-13-23(27-8)14-12-22)15-19(2)24(20(3)16-26)29-30(9,10)25(5,6)7/h11-16,18,20-21,24H,17H2,1-10H3/b19-15+/t18-,20-,21-,24-/m0/s1 |
| InChIKey | NQGNATCNEXEPPG-CSCJMKHBSA-N |
| XLogP | 6.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|