C20H32O6Si — CID 99772362
methyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-[(2R)-oxiran-2-yl]propanoate (PubChem CID 99772362) has the molecular formula C20H32O6Si and a molecular weight of 396.56 g/mol. Its IUPAC name is methyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-[(2R)-oxiran-2-yl]propanoate.
| Compound Name | methyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-[(2R)-oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 99772362 |
| Molecular Formula | C20H32O6Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-3-[(2R)-oxiran-2-yl]propanoate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc1ccc(OC)cc1)[C@H]1CO1 |
| InChI | InChI=1S/C20H32O6Si/c1-20(2,3)27(6,7)26-18(19(21)23-5)17(16-13-24-16)25-12-14-8-10-15(22-4)11-9-14/h8-11,16-18H,12-13H2,1-7H3/t16-,17+,18-/m1/s1 |
| InChIKey | YSHOJIYQOZIJJE-FGTMMUONSA-N |
| XLogP | 3.54 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|