C16H24O4 — CID 11097940
(2R)-2-[(1R,2R)-1-methoxy-2-[(4-methoxyphenyl)methoxy]-3-methylbutyl]oxirane (PubChem CID 11097940) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2R)-2-[(1R,2R)-1-methoxy-2-[(4-methoxyphenyl)methoxy]-3-methylbutyl]oxirane.
| Compound Name | (2R)-2-[(1R,2R)-1-methoxy-2-[(4-methoxyphenyl)methoxy]-3-methylbutyl]oxirane |
|---|---|
| PubChem CID | 11097940 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2R)-2-[(1R,2R)-1-methoxy-2-[(4-methoxyphenyl)methoxy]-3-methylbutyl]oxirane |
| SMILES | COc1ccc(CO[C@H](C(C)C)[C@@H](OC)[C@H]2CO2)cc1 |
| InChI | InChI=1S/C16H24O4/c1-11(2)15(16(18-4)14-10-19-14)20-9-12-5-7-13(17-3)8-6-12/h5-8,11,14-16H,9-10H2,1-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | RHNNRGBKYJIQQF-OAGGEKHMSA-N |
| XLogP | 2.65 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|