C23H36O5Si — CID 101151252
(E)-1-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-7-methyloct-3-ene-2,5-dione (PubChem CID 101151252) has the molecular formula C23H36O5Si and a molecular weight of 420.62 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-7-methyloct-3-ene-2,5-dione.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-7-methyloct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 101151252 |
| Molecular Formula | C23H36O5Si |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methoxy]-7-methyloct-3-ene-2,5-dione |
| SMILES | COc1ccc(COC(C(=O)/C=C/C(=O)CO[Si](C)(C)C(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H36O5Si/c1-17(2)22(27-15-18-9-12-20(26-6)13-10-18)21(25)14-11-19(24)16-28-29(7,8)23(3,4)5/h9-14,17,22H,15-16H2,1-8H3/b14-11+ |
| InChIKey | PIPTZPJOBTWUEE-SDNWHVSQSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|