C15H28O5Si — CID 101151250
(E)-1-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)hept-3-ene-2,5-dione (PubChem CID 101151250) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)hept-3-ene-2,5-dione.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 101151250 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)hept-3-ene-2,5-dione |
| SMILES | COCOC(C)C(=O)/C=C/C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O5Si/c1-12(19-11-18-5)14(17)9-8-13(16)10-20-21(6,7)15(2,3)4/h8-9,12H,10-11H2,1-7H3/b9-8+ |
| InChIKey | BWCSJQNIOWXLOJ-CMDGGOBGSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|