C22H46O2SiSn — CID 11488700
(E)-1-[tert-butyl(dimethyl)silyl]oxy-4-tributylstannylbut-3-en-2-one (PubChem CID 11488700) has the molecular formula C22H46O2SiSn and a molecular weight of 489.41 g/mol. Its IUPAC name is (E)-1-[tert-butyl(dimethyl)silyl]oxy-4-tributylstannylbut-3-en-2-one.
| Compound Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-4-tributylstannylbut-3-en-2-one |
|---|---|
| PubChem CID | 11488700 |
| Molecular Formula | C22H46O2SiSn |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (E)-1-[tert-butyl(dimethyl)silyl]oxy-4-tributylstannylbut-3-en-2-one |
| SMILES | CCCC[Sn](/C=C/C(=O)CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C10H19O2Si.3C4H9.Sn/c1-7-9(11)8-12-13(5,6)10(2,3)4;3*1-3-4-2;/h1,7H,8H2,2-6H3;3*1,3-4H2,2H3; |
| InChIKey | KNEYJGVBECGDBZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|