C27H56O3SiSn — CID 136590573
tert-butyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylpent-2-enoate (PubChem CID 136590573) has the molecular formula C27H56O3SiSn and a molecular weight of 575.54 g/mol. Its IUPAC name is tert-butyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylpent-2-enoate.
| Compound Name | tert-butyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylpent-2-enoate |
|---|---|
| PubChem CID | 136590573 |
| Molecular Formula | C27H56O3SiSn |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | tert-butyl (E)-5-[tert-butyl(dimethyl)silyl]oxy-3-tributylstannylpent-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(=O)OC(C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29O3Si.3C4H9.Sn/c1-14(2,3)18-13(16)11-9-10-12-17-19(7,8)15(4,5)6;3*1-3-4-2;/h11H,10,12H2,1-8H3;3*1,3-4H2,2H3; |
| InChIKey | XJBWIGFCGNOWHG-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|