C33H56O2SiSn — CID 11039475
(E)-5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-yl-3-tributylstannylpent-2-en-1-ol (PubChem CID 11039475) has the molecular formula C33H56O2SiSn and a molecular weight of 631.61 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-yl-3-tributylstannylpent-2-en-1-ol.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-yl-3-tributylstannylpent-2-en-1-ol |
|---|---|
| PubChem CID | 11039475 |
| Molecular Formula | C33H56O2SiSn |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-yl-3-tributylstannylpent-2-en-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(O)c1cccc2ccccc12)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29O2Si.3C4H9.Sn/c1-21(2,3)24(4,5)23-16-9-8-15-20(22)19-14-10-12-17-11-6-7-13-18(17)19;3*1-3-4-2;/h6-7,10-15,20,22H,9,16H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | AOCKZNLGKCDIGV-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|